C14H16ClFN2O3S — CID 133354034
4-chloro-8-fluoro-N-[2-(2-methylsulfonylethoxy)ethyl]quinolin-7-amine (PubChem CID 133354034) has the molecular formula C14H16ClFN2O3S and a molecular weight of 346.81 g/mol. Its IUPAC name is 4-chloro-8-fluoro-N-[2-(2-methylsulfonylethoxy)ethyl]quinolin-7-amine.
| Compound Name | 4-chloro-8-fluoro-N-[2-(2-methylsulfonylethoxy)ethyl]quinolin-7-amine |
|---|---|
| PubChem CID | 133354034 |
| Molecular Formula | C14H16ClFN2O3S |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-chloro-8-fluoro-N-[2-(2-methylsulfonylethoxy)ethyl]quinolin-7-amine |
| SMILES | CS(=O)(=O)CCOCCNc1ccc2c(Cl)ccnc2c1F |
| InChI | InChI=1S/C14H16ClFN2O3S/c1-22(19,20)9-8-21-7-6-17-12-3-2-10-11(15)4-5-18-14(10)13(12)16/h2-5,17H,6-9H2,1H3 |
| InChIKey | PCLQPHKIBPJDKJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|