C17H20N4O2 — CID 133361154
5,6-diethyl-3-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridazine-4-carbonitrile (PubChem CID 133361154) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 5,6-diethyl-3-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 133361154 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5,6-diethyl-3-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(NCc2cccc(OC)c2O)c(C#N)c1CC |
| InChI | InChI=1S/C17H20N4O2/c1-4-12-13(9-18)17(21-20-14(12)5-2)19-10-11-7-6-8-15(23-3)16(11)22/h6-8,22H,4-5,10H2,1-3H3,(H,19,21) |
| InChIKey | HGLVHHNXTNOKDK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|