C16H16ClN3O6S — CID 13336781
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[(4-methoxyphenyl)methoxycarbonylamino]acetic acid (PubChem CID 13336781) has the molecular formula C16H16ClN3O6S and a molecular weight of 413.84 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[(4-methoxyphenyl)methoxycarbonylamino]acetic acid.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[(4-methoxyphenyl)methoxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 13336781 |
| Molecular Formula | C16H16ClN3O6S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-[(4-methoxyphenyl)methoxycarbonylamino]acetic acid |
| SMILES | COc1ccc(COC(=O)NC(C(=O)O)c2csc(NC(=O)CCl)n2)cc1 |
| InChI | InChI=1S/C16H16ClN3O6S/c1-25-10-4-2-9(3-5-10)7-26-16(24)20-13(14(22)23)11-8-27-15(18-11)19-12(21)6-17/h2-5,8,13H,6-7H2,1H3,(H,20,24)(H,22,23)(H,18,19,21) |
| InChIKey | WCHTUBIWOSZGBP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|