C16H15N3O5S — CID 54224702
prop-2-enyl 2-nitroso-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 54224702) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is prop-2-enyl 2-nitroso-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | prop-2-enyl 2-nitroso-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 54224702 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | prop-2-enyl 2-nitroso-2-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | C=CCOC(=O)C(N=O)c1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C16H15N3O5S/c1-2-8-23-14(20)13(19-22)12-10-25-15(17-12)18-16(21)24-9-11-6-4-3-5-7-11/h2-7,10,13H,1,8-9H2,(H,17,18,21) |
| InChIKey | QFAQTOWAUBETBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|