C10H14ClN3O3S — CID 151093979
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyacetamide (PubChem CID 151093979) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyacetamide.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyacetamide |
|---|---|
| PubChem CID | 151093979 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-propan-2-yloxyacetamide |
| SMILES | CC(C)OC(C(N)=O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C10H14ClN3O3S/c1-5(2)17-8(9(12)16)6-4-18-10(13-6)14-7(15)3-11/h4-5,8H,3H2,1-2H3,(H2,12,16)(H,13,14,15) |
| InChIKey | MMSIKBFJEYXKLX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|