C19H12F5N3O — CID 133371592
4-fluoro-N-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]benzamide (PubChem CID 133371592) has the molecular formula C19H12F5N3O and a molecular weight of 393.32 g/mol. Its IUPAC name is 4-fluoro-N-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 133371592 |
| Molecular Formula | C19H12F5N3O |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-fluoro-N-[3-[[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CNc2c(F)c(F)nc(F)c2F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H12F5N3O/c20-12-6-4-11(5-7-12)19(28)26-13-3-1-2-10(8-13)9-25-16-14(21)17(23)27-18(24)15(16)22/h1-8H,9H2,(H,25,27)(H,26,28) |
| InChIKey | NXMSTQPLOYLFMX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|