C14H9N5O — CID 133392619
6-[4-(1,2,4-triazol-1-yl)phenoxy]pyridine-2-carbonitrile (PubChem CID 133392619) has the molecular formula C14H9N5O and a molecular weight of 263.26 g/mol. Its IUPAC name is 6-[4-(1,2,4-triazol-1-yl)phenoxy]pyridine-2-carbonitrile.
| Compound Name | 6-[4-(1,2,4-triazol-1-yl)phenoxy]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133392619 |
| Molecular Formula | C14H9N5O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 6-[4-(1,2,4-triazol-1-yl)phenoxy]pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(Oc2ccc(-n3cncn3)cc2)n1 |
| InChI | InChI=1S/C14H9N5O/c15-8-11-2-1-3-14(18-11)20-13-6-4-12(5-7-13)19-10-16-9-17-19/h1-7,9-10H |
| InChIKey | OILQIBXMXWTJOI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |