C16H14ClN5O4S — CID 133397206
4-[[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 133397206) has the molecular formula C16H14ClN5O4S and a molecular weight of 407.84 g/mol. Its IUPAC name is 4-[[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133397206 |
| Molecular Formula | C16H14ClN5O4S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 4-[[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | Cc1c(Nc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClN5O4S/c1-10-15(9-19-21(10)12-4-2-3-11(17)7-12)20-14-6-5-13(27(18,25)26)8-16(14)22(23)24/h2-9,20H,1H3,(H2,18,25,26) |
| InChIKey | SEUYXAJWQJKEBK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|