C23H29FN2O5 — CID 13340126
ethyl 2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-[(2-fluorobenzoyl)amino]benzoate (PubChem CID 13340126) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is ethyl 2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-[(2-fluorobenzoyl)amino]benzoate.
| Compound Name | ethyl 2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-[(2-fluorobenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 13340126 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | ethyl 2-[3-(tert-butylamino)-2-hydroxypropoxy]-5-[(2-fluorobenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)c2ccccc2F)ccc1OCC(O)CNC(C)(C)C |
| InChI | InChI=1S/C23H29FN2O5/c1-5-30-22(29)18-12-15(26-21(28)17-8-6-7-9-19(17)24)10-11-20(18)31-14-16(27)13-25-23(2,3)4/h6-12,16,25,27H,5,13-14H2,1-4H3,(H,26,28) |
| InChIKey | OFKYSRHVUNLCOT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |