C14H19N3O2S — CID 133404312
ethyl 3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate (PubChem CID 133404312) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is ethyl 3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate.
| Compound Name | ethyl 3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 133404312 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 3-[(2-ethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)Nc1nc(CC)nc2sccc12 |
| InChI | InChI=1S/C14H19N3O2S/c1-4-11-16-13(10-6-7-20-14(10)17-11)15-9(3)8-12(18)19-5-2/h6-7,9H,4-5,8H2,1-3H3,(H,15,16,17) |
| InChIKey | MQYKHMWDWXRUBX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |