C10H17N3O2S — CID 133430418
ethyl 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]butanoate (PubChem CID 133430418) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is ethyl 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]butanoate.
| Compound Name | ethyl 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]butanoate |
|---|---|
| PubChem CID | 133430418 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | ethyl 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]butanoate |
| SMILES | CCOC(=O)CC(C)Nc1nc(CC)ns1 |
| InChI | InChI=1S/C10H17N3O2S/c1-4-8-12-10(16-13-8)11-7(3)6-9(14)15-5-2/h7H,4-6H2,1-3H3,(H,11,12,13) |
| InChIKey | FBADQJZXIORSGD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |