About 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid
3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid (PubChem CID 106108447) has the molecular formula C8H13N3O3S
and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid.
Molecular Properties
| Compound Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid |
| PubChem CID | 106108447 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid |
| SMILES | CCc1nsc(NCC(OC)C(=O)O)n1 |
| InChI | InChI=1S/C8H13N3O3S/c1-3-6-10-8(15-11-6)9-4-5(14-2)7(12)13/h5H,3-4H2,1-2H3,(H,12,13)(H,9,10,11) |
| InChIKey | JRPQCZAYMPFTLH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid?
The IUPAC name of 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid (CID 106108447) is 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid.
What is the SMILES notation for 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid?
The canonical SMILES for 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid is CCc1nsc(NCC(OC)C(=O)O)n1.
What is the InChIKey of 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid?
The InChIKey is JRPQCZAYMPFTLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3S/c1-3-6-10-8(15-11-6)9-4-5(14-2)7(12)13/h5H,3-4H2,1-2H3,(H,12,13)(H,9,10,11).
What are the key properties of 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid?
3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid has a molecular weight of 231.28 g/mol, XLogP of 0.61, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]-2-methoxypropanoic acid is sourced from PubChem (CID 106108447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).