C18H18N4O2 — CID 133410872
4-[2-(1H-benzimidazol-2-ylamino)ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 133410872) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-[2-(1H-benzimidazol-2-ylamino)ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[2-(1H-benzimidazol-2-ylamino)ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 133410872 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-[2-(1H-benzimidazol-2-ylamino)ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1CCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H18N4O2/c23-16-14-10-5-6-11(9-10)15(14)17(24)22(16)8-7-19-18-20-12-3-1-2-4-13(12)21-18/h1-6,10-11,14-15H,7-9H2,(H2,19,20,21) |
| InChIKey | LOVZPTJKAJHNDP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|