C17H19N3O2 — CID 133493207
4-[2-[(2-methyl-4-pyridinyl)amino]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 133493207) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-[2-[(2-methyl-4-pyridinyl)amino]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[2-[(2-methyl-4-pyridinyl)amino]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 133493207 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[2-[(2-methyl-4-pyridinyl)amino]ethyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1cc(NCCN2C(=O)C3C4C=CC(C4)C3C2=O)ccn1 |
| InChI | InChI=1S/C17H19N3O2/c1-10-8-13(4-5-18-10)19-6-7-20-16(21)14-11-2-3-12(9-11)15(14)17(20)22/h2-5,8,11-12,14-15H,6-7,9H2,1H3,(H,18,19) |
| InChIKey | JCOWGBRUIABPHG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|