C17H19N3O3 — CID 133410971
N-[2-(3,5-dimethoxyphenoxy)ethyl]-1H-benzimidazol-2-amine (PubChem CID 133410971) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-1H-benzimidazol-2-amine.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 133410971 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-1H-benzimidazol-2-amine |
| SMILES | COc1cc(OC)cc(OCCNc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-21-12-9-13(22-2)11-14(10-12)23-8-7-18-17-19-15-5-3-4-6-16(15)20-17/h3-6,9-11H,7-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | TYYXLMATDYOOOI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|