C16H15ClFN5O — CID 133412013
1-(4-chloro-3-fluorophenyl)-2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethanol (PubChem CID 133412013) has the molecular formula C16H15ClFN5O and a molecular weight of 347.78 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethanol.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 133412013 |
| Molecular Formula | C16H15ClFN5O |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-2-[[6-(3-methylpyrazol-1-yl)pyridazin-3-yl]amino]ethanol |
| SMILES | Cc1ccn(-c2ccc(NCC(O)c3ccc(Cl)c(F)c3)nn2)n1 |
| InChI | InChI=1S/C16H15ClFN5O/c1-10-6-7-23(22-10)16-5-4-15(20-21-16)19-9-14(24)11-2-3-12(17)13(18)8-11/h2-8,14,24H,9H2,1H3,(H,19,20) |
| InChIKey | PONQVGAAIDDBSV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |