C16H26N6O — CID 133419299
4-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 133419299) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 4-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 133419299 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 4-N-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1noc(C)c1CCCNc1nc(C(C)C)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H26N6O/c1-10(2)14-18-15(20-16(19-14)22(5)6)17-9-7-8-13-11(3)21-23-12(13)4/h10H,7-9H2,1-6H3,(H,17,18,19,20) |
| InChIKey | JMZMEKYPMGOAAT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|