C15H24N8 — CID 75470602
4-N-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 75470602) has the molecular formula C15H24N8 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-N-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 75470602 |
| Molecular Formula | C15H24N8 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 4-N-[2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-yl)ethyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)c1nc(NCCc2nnc3n2CCC3)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H24N8/c1-10(2)13-17-14(19-15(18-13)22(3)4)16-8-7-12-21-20-11-6-5-9-23(11)12/h10H,5-9H2,1-4H3,(H,16,17,18,19) |
| InChIKey | BFGWUYFXUWQHHE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |