C20H30N6 — CID 133418508
4-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 133418508) has the molecular formula C20H30N6 and a molecular weight of 354.50 g/mol. Its IUPAC name is 4-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 133418508 |
| Molecular Formula | C20H30N6 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 4-N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2-N,2-N-dimethyl-6-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)c1nc(NCCCN2CCc3ccccc3C2)nc(N(C)C)n1 |
| InChI | InChI=1S/C20H30N6/c1-15(2)18-22-19(24-20(23-18)25(3)4)21-11-7-12-26-13-10-16-8-5-6-9-17(16)14-26/h5-6,8-9,15H,7,10-14H2,1-4H3,(H,21,22,23,24) |
| InChIKey | MANOFENXSOTMBF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|