C11H8N4O2S2 — CID 133425075
2-methylsulfanyl-7-(1-oxidopyridin-1-ium-2-yl)oxy-[1,3]thiazolo[4,5-d]pyrimidine (PubChem CID 133425075) has the molecular formula C11H8N4O2S2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 2-methylsulfanyl-7-(1-oxidopyridin-1-ium-2-yl)oxy-[1,3]thiazolo[4,5-d]pyrimidine.
| Compound Name | 2-methylsulfanyl-7-(1-oxidopyridin-1-ium-2-yl)oxy-[1,3]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 133425075 |
| Molecular Formula | C11H8N4O2S2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-methylsulfanyl-7-(1-oxidopyridin-1-ium-2-yl)oxy-[1,3]thiazolo[4,5-d]pyrimidine |
| SMILES | CSc1nc2ncnc(Oc3cccc[n+]3[O-])c2s1 |
| InChI | InChI=1S/C11H8N4O2S2/c1-18-11-14-9-8(19-11)10(13-6-12-9)17-7-4-2-3-5-15(7)16/h2-6H,1H3 |
| InChIKey | RNIRNMDKKTVQOH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|