C17H13N3O2S — CID 133428811
4-[4-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxy]phenoxy]benzonitrile (PubChem CID 133428811) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-[4-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxy]phenoxy]benzonitrile.
| Compound Name | 4-[4-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxy]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 133428811 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-[4-[(3-ethyl-1,2,4-thiadiazol-5-yl)oxy]phenoxy]benzonitrile |
| SMILES | CCc1nsc(Oc2ccc(Oc3ccc(C#N)cc3)cc2)n1 |
| InChI | InChI=1S/C17H13N3O2S/c1-2-16-19-17(23-20-16)22-15-9-7-14(8-10-15)21-13-5-3-12(11-18)4-6-13/h3-10H,2H2,1H3 |
| InChIKey | PQFQLYLCNUMFRJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |