C17H17N5O3S — CID 133437975
[4-nitro-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)phenyl]methanol (PubChem CID 133437975) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is [4-nitro-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)phenyl]methanol.
| Compound Name | [4-nitro-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 133437975 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [4-nitro-3-(4-thieno[3,2-d]pyrimidin-4-ylpiperazin-1-yl)phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)cc1N1CCN(c2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C17H17N5O3S/c23-10-12-1-2-14(22(24)25)15(9-12)20-4-6-21(7-5-20)17-16-13(3-8-26-16)18-11-19-17/h1-3,8-9,11,23H,4-7,10H2 |
| InChIKey | ZNARAKWLYHXICZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|