C15H19N5O4 — CID 84597821
[3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-4-nitrophenyl]methanol (PubChem CID 84597821) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is [3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 84597821 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [3-[4-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl]-4-nitrophenyl]methanol |
| SMILES | Cc1noc(CN2CCN(c3cc(CO)ccc3[N+](=O)[O-])CC2)n1 |
| InChI | InChI=1S/C15H19N5O4/c1-11-16-15(24-17-11)9-18-4-6-19(7-5-18)14-8-12(10-21)2-3-13(14)20(22)23/h2-3,8,21H,4-7,9-10H2,1H3 |
| InChIKey | DHYWQDIVUREOBY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|