C20H22N2O3 — CID 133438790
[3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol (PubChem CID 133438790) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol.
| Compound Name | [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol |
|---|---|
| PubChem CID | 133438790 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol |
| SMILES | CCc1ccc(C2=CCN(c3cc(CO)ccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-15-3-6-17(7-4-15)18-9-11-21(12-10-18)20-13-16(14-23)5-8-19(20)22(24)25/h3-9,13,23H,2,10-12,14H2,1H3 |
| InChIKey | AEDFBWLPXUBWNJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|