About [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol
[3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol (PubChem CID 133438790) has the molecular formula C20H22N2O3
and a molecular weight of 338.41 g/mol. Its IUPAC name is [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol.
Molecular Properties
| Compound Name | [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol |
| PubChem CID | 133438790 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol |
| SMILES | CCc1ccc(C2=CCN(c3cc(CO)ccc3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-15-3-6-17(7-4-15)18-9-11-21(12-10-18)20-13-16(14-23)5-8-19(20)22(24)25/h3-9,13,23H,2,10-12,14H2,1H3 |
| InChIKey | AEDFBWLPXUBWNJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol?
The IUPAC name of [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol (CID 133438790) is [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol.
What is the SMILES notation for [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol?
The canonical SMILES for [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol is CCc1ccc(C2=CCN(c3cc(CO)ccc3[N+](=O)[O-])CC2)cc1.
What is the InChIKey of [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol?
The InChIKey is AEDFBWLPXUBWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O3/c1-2-15-3-6-17(7-4-15)18-9-11-21(12-10-18)20-13-16(14-23)5-8-19(20)22(24)25/h3-9,13,23H,2,10-12,14H2,1H3.
What are the key properties of [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol?
[3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol has a molecular weight of 338.41 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(4-ethylphenyl)-3,6-dihydro-2H-pyridin-1-yl]-4-nitrophenyl]methanol is sourced from PubChem (CID 133438790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).