C18H26N2O — CID 133438117
4-[(3-ethyl-2-methylquinolin-4-yl)amino]-3,3-dimethylbutan-1-ol (PubChem CID 133438117) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[(3-ethyl-2-methylquinolin-4-yl)amino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[(3-ethyl-2-methylquinolin-4-yl)amino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 133438117 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-[(3-ethyl-2-methylquinolin-4-yl)amino]-3,3-dimethylbutan-1-ol |
| SMILES | CCc1c(C)nc2ccccc2c1NCC(C)(C)CCO |
| InChI | InChI=1S/C18H26N2O/c1-5-14-13(2)20-16-9-7-6-8-15(16)17(14)19-12-18(3,4)10-11-21/h6-9,21H,5,10-12H2,1-4H3,(H,19,20) |
| InChIKey | LXMVZIZTRXWTBH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |