C19H19N7 — CID 133449188
1-(4-methylphenyl)-N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]tetrazol-5-amine (PubChem CID 133449188) has the molecular formula C19H19N7 and a molecular weight of 345.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]tetrazol-5-amine.
| Compound Name | 1-(4-methylphenyl)-N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 133449188 |
| Molecular Formula | C19H19N7 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(4-methylphenyl)-N-[(1-methyl-3-phenylpyrazol-4-yl)methyl]tetrazol-5-amine |
| SMILES | Cc1ccc(-n2nnnc2NCc2cn(C)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N7/c1-14-8-10-17(11-9-14)26-19(21-23-24-26)20-12-16-13-25(2)22-18(16)15-6-4-3-5-7-15/h3-11,13H,12H2,1-2H3,(H,20,21,24) |
| InChIKey | HMSXMDMXXLWQFE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |