C11H7Cl2NO5S2 — CID 133451171
2-(3,4-dichlorophenoxy)-5-methylsulfonyl-3-nitrothiophene (PubChem CID 133451171) has the molecular formula C11H7Cl2NO5S2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-5-methylsulfonyl-3-nitrothiophene.
| Compound Name | 2-(3,4-dichlorophenoxy)-5-methylsulfonyl-3-nitrothiophene |
|---|---|
| PubChem CID | 133451171 |
| Molecular Formula | C11H7Cl2NO5S2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-5-methylsulfonyl-3-nitrothiophene |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(Oc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C11H7Cl2NO5S2/c1-21(17,18)10-5-9(14(15)16)11(20-10)19-6-2-3-7(12)8(13)4-6/h2-5H,1H3 |
| InChIKey | QRWXKCHILWMVQE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|