About 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one
3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 133452908) has the molecular formula C21H21N3O2
and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one |
| PubChem CID | 133452908 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1nc2ccccc2c(NCc2ccc(N3CCOC3=O)cc2)c1C |
| InChI | InChI=1S/C21H21N3O2/c1-14-15(2)23-19-6-4-3-5-18(19)20(14)22-13-16-7-9-17(10-8-16)24-11-12-26-21(24)25/h3-10H,11-13H2,1-2H3,(H,22,23) |
| InChIKey | CSVSYCPJQQUUQR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one (CID 133452908) is 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one is Cc1nc2ccccc2c(NCc2ccc(N3CCOC3=O)cc2)c1C.
What is the InChIKey of 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one?
The InChIKey is CSVSYCPJQQUUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O2/c1-14-15(2)23-19-6-4-3-5-18(19)20(14)22-13-16-7-9-17(10-8-16)24-11-12-26-21(24)25/h3-10H,11-13H2,1-2H3,(H,22,23).
What are the key properties of 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one?
3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one has a molecular weight of 347.42 g/mol, XLogP of 4.42, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(2,3-dimethylquinolin-4-yl)amino]methyl]phenyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 133452908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).