C17H20N2O3 — CID 160590052
2-anilinoethanol;3-phenyl-1,3-oxazolidin-2-one (PubChem CID 160590052) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-anilinoethanol;3-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 2-anilinoethanol;3-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 160590052 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-anilinoethanol;3-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccccc1.OCCNc1ccccc1 |
| InChI | InChI=1S/C9H9NO2.C8H11NO/c11-9-10(6-7-12-9)8-4-2-1-3-5-8;10-7-6-9-8-4-2-1-3-5-8/h1-5H,6-7H2;1-5,9-10H,6-7H2 |
| InChIKey | RCWWMSDNFZXOJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |