C22H24FN5O2 — CID 133454024
2-[(4-fluorophenyl)methyl]-3-[(3-morpholin-4-ylquinoxalin-2-yl)amino]propanamide (PubChem CID 133454024) has the molecular formula C22H24FN5O2 and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-3-[(3-morpholin-4-ylquinoxalin-2-yl)amino]propanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl]-3-[(3-morpholin-4-ylquinoxalin-2-yl)amino]propanamide |
|---|---|
| PubChem CID | 133454024 |
| Molecular Formula | C22H24FN5O2 |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-3-[(3-morpholin-4-ylquinoxalin-2-yl)amino]propanamide |
| SMILES | NC(=O)C(CNc1nc2ccccc2nc1N1CCOCC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN5O2/c23-17-7-5-15(6-8-17)13-16(20(24)29)14-25-21-22(28-9-11-30-12-10-28)27-19-4-2-1-3-18(19)26-21/h1-8,16H,9-14H2,(H2,24,29)(H,25,26) |
| InChIKey | DELMYJWXRNOQEP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |