C21H21BrN2O2 — CID 133457322
4-acetyl-2-[[4-(4-bromophenyl)oxan-4-yl]methylamino]benzonitrile (PubChem CID 133457322) has the molecular formula C21H21BrN2O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is 4-acetyl-2-[[4-(4-bromophenyl)oxan-4-yl]methylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[[4-(4-bromophenyl)oxan-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 133457322 |
| Molecular Formula | C21H21BrN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 4-acetyl-2-[[4-(4-bromophenyl)oxan-4-yl]methylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCC2(c3ccc(Br)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C21H21BrN2O2/c1-15(25)16-2-3-17(13-23)20(12-16)24-14-21(8-10-26-11-9-21)18-4-6-19(22)7-5-18/h2-7,12,24H,8-11,14H2,1H3 |
| InChIKey | MNVUXPMROAAYIC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |