C20H19ClN2O3 — CID 154860358
2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylamino]-4-chlorobenzonitrile (PubChem CID 154860358) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylamino]-4-chlorobenzonitrile.
| Compound Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylamino]-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 154860358 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylamino]-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C20H19ClN2O3/c21-16-3-1-14(11-22)17(10-16)23-12-20(5-7-24-8-6-20)15-2-4-18-19(9-15)26-13-25-18/h1-4,9-10,23H,5-8,12-13H2 |
| InChIKey | ODJWVJOMWCUKRC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |