C15H22N2O5S — CID 122141076
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylsulfamoyl]ethanamine (PubChem CID 122141076) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylsulfamoyl]ethanamine.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylsulfamoyl]ethanamine |
|---|---|
| PubChem CID | 122141076 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methylsulfamoyl]ethanamine |
| SMILES | CCNS(=O)(=O)NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C15H22N2O5S/c1-2-16-23(18,19)17-10-15(5-7-20-8-6-15)12-3-4-13-14(9-12)22-11-21-13/h3-4,9,16-17H,2,5-8,10-11H2,1H3 |
| InChIKey | IOVCJSPGVRJKGO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |