C19H16F2N2O2 — CID 133457479
4-acetyl-2-[2-(3,4-difluorophenyl)morpholin-4-yl]benzonitrile (PubChem CID 133457479) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-acetyl-2-[2-(3,4-difluorophenyl)morpholin-4-yl]benzonitrile.
| Compound Name | 4-acetyl-2-[2-(3,4-difluorophenyl)morpholin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 133457479 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-acetyl-2-[2-(3,4-difluorophenyl)morpholin-4-yl]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(N2CCOC(c3ccc(F)c(F)c3)C2)c1 |
| InChI | InChI=1S/C19H16F2N2O2/c1-12(24)13-2-3-15(10-22)18(9-13)23-6-7-25-19(11-23)14-4-5-16(20)17(21)8-14/h2-5,8-9,19H,6-7,11H2,1H3 |
| InChIKey | URLQOXOMDPZALT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |