About 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one
1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one (PubChem CID 133464320) has the molecular formula C16H20N6O2S
and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one |
| PubChem CID | 133464320 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one |
| SMILES | CN1CCN(c2cc(N3CCOC(c4nccs4)C3)ncn2)CC1=O |
| InChI | InChI=1S/C16H20N6O2S/c1-20-3-4-21(10-15(20)23)13-8-14(19-11-18-13)22-5-6-24-12(9-22)16-17-2-7-25-16/h2,7-8,11-12H,3-6,9-10H2,1H3 |
| InChIKey | OUOGEFWCNIXUAV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one?
The IUPAC name of 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one (CID 133464320) is 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one.
What is the SMILES notation for 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one?
The canonical SMILES for 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one is CN1CCN(c2cc(N3CCOC(c4nccs4)C3)ncn2)CC1=O.
What is the InChIKey of 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one?
The InChIKey is OUOGEFWCNIXUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6O2S/c1-20-3-4-21(10-15(20)23)13-8-14(19-11-18-13)22-5-6-24-12(9-22)16-17-2-7-25-16/h2,7-8,11-12H,3-6,9-10H2,1H3.
What are the key properties of 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one?
1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one has a molecular weight of 360.44 g/mol, XLogP of 0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[6-[2-(1,3-thiazol-2-yl)morpholin-4-yl]pyrimidin-4-yl]piperazin-2-one is sourced from PubChem (CID 133464320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).