C13H13N5OS — CID 164634498
(2S)-4-imidazo[1,2-a]pyrazin-8-yl-2-(1,3-thiazol-2-yl)morpholine (PubChem CID 164634498) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is (2S)-4-imidazo[1,2-a]pyrazin-8-yl-2-(1,3-thiazol-2-yl)morpholine.
| Compound Name | (2S)-4-imidazo[1,2-a]pyrazin-8-yl-2-(1,3-thiazol-2-yl)morpholine |
|---|---|
| PubChem CID | 164634498 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (2S)-4-imidazo[1,2-a]pyrazin-8-yl-2-(1,3-thiazol-2-yl)morpholine |
| SMILES | c1csc([C@@H]2CN(c3nccn4ccnc34)CCO2)n1 |
| InChI | InChI=1S/C13H13N5OS/c1-4-17-5-2-15-12(11(17)14-1)18-6-7-19-10(9-18)13-16-3-8-20-13/h1-5,8,10H,6-7,9H2/t10-/m0/s1 |
| InChIKey | YJZZUTIOEWNXQA-JTQLQIEISA-N |
| XLogP | 1.76 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |