C14H21N5OS — CID 133464428
1-methyl-4-[6-(2-methylthiomorpholin-4-yl)pyrimidin-4-yl]piperazin-2-one (PubChem CID 133464428) has the molecular formula C14H21N5OS and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-methyl-4-[6-(2-methylthiomorpholin-4-yl)pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 1-methyl-4-[6-(2-methylthiomorpholin-4-yl)pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 133464428 |
| Molecular Formula | C14H21N5OS |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-methyl-4-[6-(2-methylthiomorpholin-4-yl)pyrimidin-4-yl]piperazin-2-one |
| SMILES | CC1CN(c2cc(N3CCN(C)C(=O)C3)ncn2)CCS1 |
| InChI | InChI=1S/C14H21N5OS/c1-11-8-19(5-6-21-11)13-7-12(15-10-16-13)18-4-3-17(2)14(20)9-18/h7,10-11H,3-6,8-9H2,1-2H3 |
| InChIKey | ZMXPUIONWXKKNW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |