C16H24N6O2 — CID 133490381
2-[1-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]piperidin-3-yl]acetamide (PubChem CID 133490381) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[1-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]piperidin-3-yl]acetamide.
| Compound Name | 2-[1-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 133490381 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[1-[6-(4-methyl-3-oxopiperazin-1-yl)pyrimidin-4-yl]piperidin-3-yl]acetamide |
| SMILES | CN1CCN(c2cc(N3CCCC(CC(N)=O)C3)ncn2)CC1=O |
| InChI | InChI=1S/C16H24N6O2/c1-20-5-6-22(10-16(20)24)15-8-14(18-11-19-15)21-4-2-3-12(9-21)7-13(17)23/h8,11-12H,2-7,9-10H2,1H3,(H2,17,23) |
| InChIKey | ANDYNZRYGMUZNL-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |