C21H30N2O2S — CID 13346873
9a-morpholin-4-yl-3-(2,4,6-trimethylphenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d][1,2]oxazole (PubChem CID 13346873) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is 9a-morpholin-4-yl-3-(2,4,6-trimethylphenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d][1,2]oxazole.
| Compound Name | 9a-morpholin-4-yl-3-(2,4,6-trimethylphenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d][1,2]oxazole |
|---|---|
| PubChem CID | 13346873 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 9a-morpholin-4-yl-3-(2,4,6-trimethylphenyl)-3a,4,5,7,8,9-hexahydrothiocino[4,5-d][1,2]oxazole |
| SMILES | Cc1cc(C)c(C2=NOC3(N4CCOCC4)CCCSCCC23)c(C)c1 |
| InChI | InChI=1S/C21H30N2O2S/c1-15-13-16(2)19(17(3)14-15)20-18-5-12-26-11-4-6-21(18,25-22-20)23-7-9-24-10-8-23/h13-14,18H,4-12H2,1-3H3 |
| InChIKey | ZMPRDNKOLROKHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |