C17H16F2N4O2 — CID 133469874
4-[4-(2,4-difluorobenzoyl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 133469874) has the molecular formula C17H16F2N4O2 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-[4-(2,4-difluorobenzoyl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 4-[4-(2,4-difluorobenzoyl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133469874 |
| Molecular Formula | C17H16F2N4O2 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 4-[4-(2,4-difluorobenzoyl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnccc1N1CCN(C(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H16F2N4O2/c18-11-1-2-12(14(19)9-11)17(25)23-7-5-22(6-8-23)15-3-4-21-10-13(15)16(20)24/h1-4,9-10H,5-8H2,(H2,20,24) |
| InChIKey | RJBBLUMJBQGFCZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |