C19H21F2N3O3S — CID 133473497
6-[(2-cyclopropyloxan-4-yl)amino]-N-(3,4-difluorophenyl)pyridine-3-sulfonamide (PubChem CID 133473497) has the molecular formula C19H21F2N3O3S and a molecular weight of 409.46 g/mol. Its IUPAC name is 6-[(2-cyclopropyloxan-4-yl)amino]-N-(3,4-difluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 6-[(2-cyclopropyloxan-4-yl)amino]-N-(3,4-difluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133473497 |
| Molecular Formula | C19H21F2N3O3S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 6-[(2-cyclopropyloxan-4-yl)amino]-N-(3,4-difluorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)c(F)c1)c1ccc(NC2CCOC(C3CC3)C2)nc1 |
| InChI | InChI=1S/C19H21F2N3O3S/c20-16-5-3-14(9-17(16)21)24-28(25,26)15-4-6-19(22-11-15)23-13-7-8-27-18(10-13)12-1-2-12/h3-6,9,11-13,18,24H,1-2,7-8,10H2,(H,22,23) |
| InChIKey | NTGMKEYOCBAJQZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |