C20H21N3O2 — CID 133474067
3-(4-methylphenyl)-N-(2-phenyloxan-4-yl)-1,2,4-oxadiazol-5-amine (PubChem CID 133474067) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(2-phenyloxan-4-yl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(4-methylphenyl)-N-(2-phenyloxan-4-yl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 133474067 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-(4-methylphenyl)-N-(2-phenyloxan-4-yl)-1,2,4-oxadiazol-5-amine |
| SMILES | Cc1ccc(-c2noc(NC3CCOC(c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-14-7-9-16(10-8-14)19-22-20(25-23-19)21-17-11-12-24-18(13-17)15-5-3-2-4-6-15/h2-10,17-18H,11-13H2,1H3,(H,21,22,23) |
| InChIKey | MBPSQWSHDJZSSB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |