C20H22N4O2 — CID 133482280
3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-phenyl-1,2,4-oxadiazole (PubChem CID 133482280) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-phenyl-1,2,4-oxadiazole.
| Compound Name | 3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133482280 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]-5-phenyl-1,2,4-oxadiazole |
| SMILES | COc1ccc(N2CCCN(c3noc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-25-18-10-8-17(9-11-18)23-12-5-13-24(15-14-23)20-21-19(26-22-20)16-6-3-2-4-7-16/h2-4,6-11H,5,12-15H2,1H3 |
| InChIKey | FSAQOFJYLPFKLG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|