About 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile
5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile (PubChem CID 133485338) has the molecular formula C17H16Cl2N4
and a molecular weight of 347.25 g/mol. Its IUPAC name is 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile |
| PubChem CID | 133485338 |
| Molecular Formula | C17H16Cl2N4 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(N2CCC(Cc3cc(Cl)ccc3Cl)CC2)cn1 |
| InChI | InChI=1S/C17H16Cl2N4/c18-14-1-2-16(19)13(8-14)7-12-3-5-23(6-4-12)17-11-21-15(9-20)10-22-17/h1-2,8,10-12H,3-7H2 |
| InChIKey | FCGYOPVAFWWSNB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile?
The IUPAC name of 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile (CID 133485338) is 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile?
The canonical SMILES for 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile is N#Cc1cnc(N2CCC(Cc3cc(Cl)ccc3Cl)CC2)cn1.
What is the InChIKey of 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile?
The InChIKey is FCGYOPVAFWWSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N4/c18-14-1-2-16(19)13(8-14)7-12-3-5-23(6-4-12)17-11-21-15(9-20)10-22-17/h1-2,8,10-12H,3-7H2.
What are the key properties of 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile?
5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile has a molecular weight of 347.25 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(2,5-dichlorophenyl)methyl]piperidin-1-yl]pyrazine-2-carbonitrile is sourced from PubChem (CID 133485338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).