C17H15Cl2N3O3 — CID 133490811
4-chloro-2-(4-chlorophenyl)-5-[[1-(furan-2-yl)-3-hydroxypropyl]amino]pyridazin-3-one (PubChem CID 133490811) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is 4-chloro-2-(4-chlorophenyl)-5-[[1-(furan-2-yl)-3-hydroxypropyl]amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chlorophenyl)-5-[[1-(furan-2-yl)-3-hydroxypropyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 133490811 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 4-chloro-2-(4-chlorophenyl)-5-[[1-(furan-2-yl)-3-hydroxypropyl]amino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC(CCO)c2ccco2)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-11-3-5-12(6-4-11)22-17(24)16(19)14(10-20-22)21-13(7-8-23)15-2-1-9-25-15/h1-6,9-10,13,21,23H,7-8H2 |
| InChIKey | UJLXQIBBERQSGS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |