C18H21F2N3O — CID 133494089
6,8-difluoro-4-[4-(oxan-4-yl)piperazin-1-yl]quinoline (PubChem CID 133494089) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 6,8-difluoro-4-[4-(oxan-4-yl)piperazin-1-yl]quinoline.
| Compound Name | 6,8-difluoro-4-[4-(oxan-4-yl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 133494089 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6,8-difluoro-4-[4-(oxan-4-yl)piperazin-1-yl]quinoline |
| SMILES | Fc1cc(F)c2nccc(N3CCN(C4CCOCC4)CC3)c2c1 |
| InChI | InChI=1S/C18H21F2N3O/c19-13-11-15-17(1-4-21-18(15)16(20)12-13)23-7-5-22(6-8-23)14-2-9-24-10-3-14/h1,4,11-12,14H,2-3,5-10H2 |
| InChIKey | RNWVQWLGBUDSIJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |