C13H22N4O4S — CID 133496927
4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-diethyl-1,4-thiazinane 1,1-dioxide (PubChem CID 133496927) has the molecular formula C13H22N4O4S and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-diethyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-diethyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 133496927 |
| Molecular Formula | C13H22N4O4S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2,2-diethyl-1,4-thiazinane 1,1-dioxide |
| SMILES | CCC1(CC)CN(c2c([N+](=O)[O-])c(C)nn2C)CCS1(=O)=O |
| InChI | InChI=1S/C13H22N4O4S/c1-5-13(6-2)9-16(7-8-22(13,20)21)12-11(17(18)19)10(3)14-15(12)4/h5-9H2,1-4H3 |
| InChIKey | FFXKRPAUPZWHGG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|