C13H21N5O3 — CID 56574364
1-[4-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 56574364) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[4-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 56574364 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-[4-(1,3-dimethyl-4-nitropyrazol-5-yl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(c2c([N+](=O)[O-])c(C)nn2C)CC1 |
| InChI | InChI=1S/C13H21N5O3/c1-4-11(19)16-6-5-7-17(9-8-16)13-12(18(20)21)10(2)14-15(13)3/h4-9H2,1-3H3 |
| InChIKey | PASCMBBFQSTJJS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|