About 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile
2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile (PubChem CID 133497761) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile |
| PubChem CID | 133497761 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile |
| SMILES | N#CCC1(O)CN(c2ncnc3c2oc2ccccc23)C1 |
| InChI | InChI=1S/C15H12N4O2/c16-6-5-15(20)7-19(8-15)14-13-12(17-9-18-14)10-3-1-2-4-11(10)21-13/h1-4,9,20H,5,7-8H2 |
| InChIKey | JESMCECBMWQAHL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile?
The IUPAC name of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile (CID 133497761) is 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile.
What is the SMILES notation for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile?
The canonical SMILES for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile is N#CCC1(O)CN(c2ncnc3c2oc2ccccc23)C1.
What is the InChIKey of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile?
The InChIKey is JESMCECBMWQAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2/c16-6-5-15(20)7-19(8-15)14-13-12(17-9-18-14)10-3-1-2-4-11(10)21-13/h1-4,9,20H,5,7-8H2.
What are the key properties of 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile?
2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile has a molecular weight of 280.29 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-([1]benzofuro[3,2-d]pyrimidin-4-yl)-3-hydroxyazetidin-3-yl]acetonitrile is sourced from PubChem (CID 133497761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).