C13H16ClNO3 — CID 13349844
[(Z)-4-chloro-4-(2-formyl-4,5-dimethyl-1H-pyrrol-3-yl)but-3-enyl] acetate (PubChem CID 13349844) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is [(Z)-4-chloro-4-(2-formyl-4,5-dimethyl-1H-pyrrol-3-yl)but-3-enyl] acetate.
| Compound Name | [(Z)-4-chloro-4-(2-formyl-4,5-dimethyl-1H-pyrrol-3-yl)but-3-enyl] acetate |
|---|---|
| PubChem CID | 13349844 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [(Z)-4-chloro-4-(2-formyl-4,5-dimethyl-1H-pyrrol-3-yl)but-3-enyl] acetate |
| SMILES | CC(=O)OCC/C=C(\Cl)c1c(C=O)[nH]c(C)c1C |
| InChI | InChI=1S/C13H16ClNO3/c1-8-9(2)15-12(7-16)13(8)11(14)5-4-6-18-10(3)17/h5,7,15H,4,6H2,1-3H3/b11-5- |
| InChIKey | KRJFDRQMTDXZDH-WZUFQYTHSA-N |
| XLogP | 2.98 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|